About N-ethenyl-N,2-diethylhexanamide
N-ethenyl-N,2-diethylhexanamide (PubChem CID 87457949) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is N-ethenyl-N,2-diethylhexanamide.
Molecular Properties
| Compound Name | N-ethenyl-N,2-diethylhexanamide |
| PubChem CID | 87457949 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-ethenyl-N,2-diethylhexanamide |
| SMILES | C=CN(CC)C(=O)C(CC)CCCC |
| InChI | InChI=1S/C12H23NO/c1-5-9-10-11(6-2)12(14)13(7-3)8-4/h7,11H,3,5-6,8-10H2,1-2,4H3 |
| InChIKey | TVVWKZKAASRXDY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethenyl-N,2-diethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N,2-diethylhexanamide?
The IUPAC name of N-ethenyl-N,2-diethylhexanamide (CID 87457949) is N-ethenyl-N,2-diethylhexanamide.
What is the SMILES notation for N-ethenyl-N,2-diethylhexanamide?
The canonical SMILES for N-ethenyl-N,2-diethylhexanamide is C=CN(CC)C(=O)C(CC)CCCC.
What is the InChIKey of N-ethenyl-N,2-diethylhexanamide?
The InChIKey is TVVWKZKAASRXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-5-9-10-11(6-2)12(14)13(7-3)8-4/h7,11H,3,5-6,8-10H2,1-2,4H3.
What are the key properties of N-ethenyl-N,2-diethylhexanamide?
N-ethenyl-N,2-diethylhexanamide has a molecular weight of 197.32 g/mol, XLogP of 3.19, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N,2-diethylhexanamide is sourced from PubChem (CID 87457949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).