C18H23NO3S — CID 101073211
(3aR,8Z,9aS)-3a-methyl-2-(4-methylphenyl)sulfonyl-1,3,4,6,7,9a-hexahydrocycloocta[c]pyrrol-5-one (PubChem CID 101073211) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is (3aR,8Z,9aS)-3a-methyl-2-(4-methylphenyl)sulfonyl-1,3,4,6,7,9a-hexahydrocycloocta[c]pyrrol-5-one.
| Compound Name | (3aR,8Z,9aS)-3a-methyl-2-(4-methylphenyl)sulfonyl-1,3,4,6,7,9a-hexahydrocycloocta[c]pyrrol-5-one |
|---|---|
| PubChem CID | 101073211 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (3aR,8Z,9aS)-3a-methyl-2-(4-methylphenyl)sulfonyl-1,3,4,6,7,9a-hexahydrocycloocta[c]pyrrol-5-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3/C=C\CCC(=O)C[C@@]3(C)C2)cc1 |
| InChI | InChI=1S/C18H23NO3S/c1-14-7-9-17(10-8-14)23(21,22)19-12-15-5-3-4-6-16(20)11-18(15,2)13-19/h3,5,7-10,15H,4,6,11-13H2,1-2H3/b5-3-/t15-,18+/m1/s1 |
| InChIKey | JTOYXZCONFBTJD-JKNDFLROSA-N |
| XLogP | 2.93 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|