C18H33NO9 — CID 101074455
ethyl 3-[2-amino-2,3-bis(3-ethoxy-3-oxopropoxy)propoxy]propanoate (PubChem CID 101074455) has the molecular formula C18H33NO9 and a molecular weight of 407.46 g/mol. Its IUPAC name is ethyl 3-[2-amino-2,3-bis(3-ethoxy-3-oxopropoxy)propoxy]propanoate.
| Compound Name | ethyl 3-[2-amino-2,3-bis(3-ethoxy-3-oxopropoxy)propoxy]propanoate |
|---|---|
| PubChem CID | 101074455 |
| Molecular Formula | C18H33NO9 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | ethyl 3-[2-amino-2,3-bis(3-ethoxy-3-oxopropoxy)propoxy]propanoate |
| SMILES | CCOC(=O)CCOCC(N)(COCCC(=O)OCC)OCCC(=O)OCC |
| InChI | InChI=1S/C18H33NO9/c1-4-25-15(20)7-10-23-13-18(19,28-12-9-17(22)27-6-3)14-24-11-8-16(21)26-5-2/h4-14,19H2,1-3H3 |
| InChIKey | QJFPYVJAGGMCMB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 132.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|