About ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane
ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane (PubChem CID 161148650) has the molecular formula C26H54O10
and a molecular weight of 526.71 g/mol. Its IUPAC name is ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane.
Molecular Properties
| Compound Name | ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane |
| PubChem CID | 161148650 |
| Molecular Formula | C26H54O10 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane |
| SMILES | C.CCCCOCCOCCOCCC(=O)OCC.CCCOCCOCCOCCC(=O)OCC |
| InChI | InChI=1S/C13H26O5.C12H24O5.CH4/c1-3-5-7-15-9-11-17-12-10-16-8-6-13(14)18-4-2;1-3-6-14-8-10-16-11-9-15-7-5-12(13)17-4-2;/h3-12H2,1-2H3;3-11H2,1-2H3;1H4 |
| InChIKey | UOJRTZTUGALEHH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane?
The IUPAC name of ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane (CID 161148650) is ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane.
What is the SMILES notation for ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane?
The canonical SMILES for ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane is C.CCCCOCCOCCOCCC(=O)OCC.CCCOCCOCCOCCC(=O)OCC.
What is the InChIKey of ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane?
The InChIKey is UOJRTZTUGALEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5.C12H24O5.CH4/c1-3-5-7-15-9-11-17-12-10-16-8-6-13(14)18-4-2;1-3-6-14-8-10-16-11-9-15-7-5-12(13)17-4-2;/h3-12H2,1-2H3;3-11H2,1-2H3;1H4.
What are the key properties of ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane?
ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane has a molecular weight of 526.71 g/mol, XLogP of 3.83, 25 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(2-butoxyethoxy)ethoxy]propanoate;ethyl 3-[2-(2-propoxyethoxy)ethoxy]propanoate;methane is sourced from PubChem (CID 161148650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).