C50H46O10 — CID 101074978
ethyl 4-[2,3,4,5-tetrakis(4-ethoxycarbonylphenyl)cyclopenta-2,4-dien-1-yl]benzoate (PubChem CID 101074978) has the molecular formula C50H46O10 and a molecular weight of 806.91 g/mol. Its IUPAC name is ethyl 4-[2,3,4,5-tetrakis(4-ethoxycarbonylphenyl)cyclopenta-2,4-dien-1-yl]benzoate.
| Compound Name | ethyl 4-[2,3,4,5-tetrakis(4-ethoxycarbonylphenyl)cyclopenta-2,4-dien-1-yl]benzoate |
|---|---|
| PubChem CID | 101074978 |
| Molecular Formula | C50H46O10 |
| Molecular Weight | 806.91 g/mol |
| Exact Mass | 806.31 |
| IUPAC Name | ethyl 4-[2,3,4,5-tetrakis(4-ethoxycarbonylphenyl)cyclopenta-2,4-dien-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C2=C(c3ccc(C(=O)OCC)cc3)C(c3ccc(C(=O)OCC)cc3)C(c3ccc(C(=O)OCC)cc3)=C2c2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C50H46O10/c1-6-56-46(51)36-21-11-31(12-22-36)41-42(32-13-23-37(24-14-32)47(52)57-7-2)44(34-17-27-39(28-18-34)49(54)59-9-4)45(35-19-29-40(30-20-35)50(55)60-10-5)43(41)33-15-25-38(26-16-33)48(53)58-8-3/h11-30,41H,6-10H2,1-5H3 |
| InChIKey | ITJRNBDSYFFEKT-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.91 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|