C7H9BrN4S — CID 101075798
(5-bromo-2,6-dimethylpyrimidin-4-yl)thiourea (PubChem CID 101075798) has the molecular formula C7H9BrN4S and a molecular weight of 261.15 g/mol. Its IUPAC name is (5-bromo-2,6-dimethylpyrimidin-4-yl)thiourea.
| Compound Name | (5-bromo-2,6-dimethylpyrimidin-4-yl)thiourea |
|---|---|
| PubChem CID | 101075798 |
| Molecular Formula | C7H9BrN4S |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | (5-bromo-2,6-dimethylpyrimidin-4-yl)thiourea |
| SMILES | Cc1nc(C)c(Br)c(NC(N)=S)n1 |
| InChI | InChI=1S/C7H9BrN4S/c1-3-5(8)6(12-7(9)13)11-4(2)10-3/h1-2H3,(H3,9,10,11,12,13) |
| InChIKey | PQTLLFZGFFJKBZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|