C28H38O3 — CID 101077313
tert-butyl 2-[(1S)-5-[[(1R,2S,4R)-1,7,7-trimethyl-2-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohexa-2,4-dien-1-yl]acetate (PubChem CID 101077313) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is tert-butyl 2-[(1S)-5-[[(1R,2S,4R)-1,7,7-trimethyl-2-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohexa-2,4-dien-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1S)-5-[[(1R,2S,4R)-1,7,7-trimethyl-2-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohexa-2,4-dien-1-yl]acetate |
|---|---|
| PubChem CID | 101077313 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | tert-butyl 2-[(1S)-5-[[(1R,2S,4R)-1,7,7-trimethyl-2-phenyl-2-bicyclo[2.2.1]heptanyl]oxy]cyclohexa-2,4-dien-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C=CC=C(O[C@]2(c3ccccc3)C[C@H]3CC[C@]2(C)C3(C)C)C1 |
| InChI | InChI=1S/C28H38O3/c1-25(2,3)31-24(29)18-20-11-10-14-23(17-20)30-28(21-12-8-7-9-13-21)19-22-15-16-27(28,6)26(22,4)5/h7-14,20,22H,15-19H2,1-6H3/t20-,22+,27+,28-/m0/s1 |
| InChIKey | LGBKGQIUZDEBAK-LGNTYQEESA-N |
| XLogP | 6.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |