C17H32O2Si — CID 101077758
tert-butyl-[[(1S,2S)-2-(cyclohexen-1-yl)-2-methoxycyclopropyl]methoxy]-dimethylsilane (PubChem CID 101077758) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S)-2-(cyclohexen-1-yl)-2-methoxycyclopropyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S)-2-(cyclohexen-1-yl)-2-methoxycyclopropyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101077758 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl-[[(1S,2S)-2-(cyclohexen-1-yl)-2-methoxycyclopropyl]methoxy]-dimethylsilane |
| SMILES | CO[C@@]1(C2=CCCCC2)C[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-16(2,3)20(5,6)19-13-15-12-17(15,18-4)14-10-8-7-9-11-14/h10,15H,7-9,11-13H2,1-6H3/t15-,17+/m0/s1 |
| InChIKey | AQCYFMZOLJYTCM-DOTOQJQBSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|