C25H17NO4 — CID 101078433
8-(4-methoxybenzoyl)-11-methyl-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione (PubChem CID 101078433) has the molecular formula C25H17NO4 and a molecular weight of 395.41 g/mol. Its IUPAC name is 8-(4-methoxybenzoyl)-11-methyl-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione.
| Compound Name | 8-(4-methoxybenzoyl)-11-methyl-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 101078433 |
| Molecular Formula | C25H17NO4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 8-(4-methoxybenzoyl)-11-methyl-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione |
| SMILES | COc1ccc(C(=O)c2c3c4c(cccc4c4ccccc24)C(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C25H17NO4/c1-26-24(28)19-9-5-8-17-16-6-3-4-7-18(16)21(22(20(17)19)25(26)29)23(27)14-10-12-15(30-2)13-11-14/h3-13H,1-2H3 |
| InChIKey | OYHPEXMUONNUBJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|