C22H13N3O3 — CID 46216922
11-methyl-8-(pyrimidine-5-carbonyl)-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione (PubChem CID 46216922) has the molecular formula C22H13N3O3 and a molecular weight of 367.36 g/mol. Its IUPAC name is 11-methyl-8-(pyrimidine-5-carbonyl)-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione.
| Compound Name | 11-methyl-8-(pyrimidine-5-carbonyl)-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 46216922 |
| Molecular Formula | C22H13N3O3 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 11-methyl-8-(pyrimidine-5-carbonyl)-11-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene-10,12-dione |
| SMILES | CN1C(=O)c2cccc3c2c(c(C(=O)c2cncnc2)c2ccccc23)C1=O |
| InChI | InChI=1S/C22H13N3O3/c1-25-21(27)16-8-4-7-14-13-5-2-3-6-15(13)18(19(17(14)16)22(25)28)20(26)12-9-23-11-24-10-12/h2-11H,1H3 |
| InChIKey | WVZHZJBKYKAPKH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|