C18H13BrClNO2 — CID 1010815
2-(1-bromonaphthalen-2-yl)oxy-N-(4-chlorophenyl)acetamide (PubChem CID 1010815) has the molecular formula C18H13BrClNO2 and a molecular weight of 390.66 g/mol. Its IUPAC name is 2-(1-bromonaphthalen-2-yl)oxy-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-(1-bromonaphthalen-2-yl)oxy-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 1010815 |
| Molecular Formula | C18H13BrClNO2 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-(1-bromonaphthalen-2-yl)oxy-N-(4-chlorophenyl)acetamide |
| SMILES | O=C(COc1ccc2ccccc2c1Br)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13BrClNO2/c19-18-15-4-2-1-3-12(15)5-10-16(18)23-11-17(22)21-14-8-6-13(20)7-9-14/h1-10H,11H2,(H,21,22) |
| InChIKey | LOKVHCCLVBXCCC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |