C19H13BrCl2N2O3 — CID 3367158
N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-2,4-dichlorobenzohydrazide (PubChem CID 3367158) has the molecular formula C19H13BrCl2N2O3 and a molecular weight of 468.13 g/mol. Its IUPAC name is N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 3367158 |
| Molecular Formula | C19H13BrCl2N2O3 |
| Molecular Weight | 468.13 g/mol |
| Exact Mass | 465.95 |
| IUPAC Name | N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-2,4-dichlorobenzohydrazide |
| SMILES | O=C(COc1ccc2ccccc2c1Br)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H13BrCl2N2O3/c20-18-13-4-2-1-3-11(13)5-8-16(18)27-10-17(25)23-24-19(26)14-7-6-12(21)9-15(14)22/h1-9H,10H2,(H,23,25)(H,24,26) |
| InChIKey | YPTUIMNBLXCTOE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.13 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|