C18H17BrCl2N2O3 — CID 17189044
N'-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-2,4-dichlorobenzohydrazide (PubChem CID 17189044) has the molecular formula C18H17BrCl2N2O3 and a molecular weight of 460.16 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 17189044 |
| Molecular Formula | C18H17BrCl2N2O3 |
| Molecular Weight | 460.16 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | N'-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-2,4-dichlorobenzohydrazide |
| SMILES | CC(C)c1cc(Br)ccc1OCC(=O)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17BrCl2N2O3/c1-10(2)14-7-11(19)3-6-16(14)26-9-17(24)22-23-18(25)13-5-4-12(20)8-15(13)21/h3-8,10H,9H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | KSKKCERIYHIZDR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|