C10H11N — CID 101081502
(8R)-1-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 101081502) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is (8R)-1-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (8R)-1-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 101081502 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | (8R)-1-azatricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C10H11N/c1-2-4-10-9(3-1)8-5-6-11(10)7-8/h1-4,8H,5-7H2/t8-/m0/s1 |
| InChIKey | UJFYPTYOEWDYGL-QMMMGPOBSA-N |
| XLogP | 1.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |