C11H13N — CID 54504449
1-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene (PubChem CID 54504449) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 1-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 54504449 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1-azatricyclo[6.3.1.02,7]dodeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)C1CCCN2C1 |
| InChI | InChI=1S/C11H13N/c1-2-6-11-10(5-1)9-4-3-7-12(11)8-9/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | YESBHQCNKBCHHR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |