C9H5N3S2 — CID 101081953
5-phenylsulfanyl-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 101081953) has the molecular formula C9H5N3S2 and a molecular weight of 219.29 g/mol. Its IUPAC name is 5-phenylsulfanyl-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-phenylsulfanyl-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 101081953 |
| Molecular Formula | C9H5N3S2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | 5-phenylsulfanyl-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | N#Cc1nnc(Sc2ccccc2)s1 |
| InChI | InChI=1S/C9H5N3S2/c10-6-8-11-12-9(14-8)13-7-4-2-1-3-5-7/h1-5H |
| InChIKey | YQPONTWSBDKSSL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |