C22H22N2O2 — CID 101082068
ethyl 3,3-bis(1H-indol-3-yl)butanoate (PubChem CID 101082068) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 3,3-bis(1H-indol-3-yl)butanoate.
| Compound Name | ethyl 3,3-bis(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 101082068 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | ethyl 3,3-bis(1H-indol-3-yl)butanoate |
| SMILES | CCOC(=O)CC(C)(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H22N2O2/c1-3-26-21(25)12-22(2,17-13-23-19-10-6-4-8-15(17)19)18-14-24-20-11-7-5-9-16(18)20/h4-11,13-14,23-24H,3,12H2,1-2H3 |
| InChIKey | SRKQSZFOSKVGMH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |