C52H69N3O5 — CID 101082082
1-[2-[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]-1,3-dioxoisoindol-5-yl]-3-hexylurea (PubChem CID 101082082) has the molecular formula C52H69N3O5 and a molecular weight of 816.14 g/mol. Its IUPAC name is 1-[2-[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]-1,3-dioxoisoindol-5-yl]-3-hexylurea.
| Compound Name | 1-[2-[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]-1,3-dioxoisoindol-5-yl]-3-hexylurea |
|---|---|
| PubChem CID | 101082082 |
| Molecular Formula | C52H69N3O5 |
| Molecular Weight | 816.14 g/mol |
| Exact Mass | 815.52 |
| IUPAC Name | 1-[2-[[3,5-bis[(3,5-ditert-butylphenyl)methoxy]phenyl]methyl]-1,3-dioxoisoindol-5-yl]-3-hexylurea |
| SMILES | CCCCCCNC(=O)Nc1ccc2c(c1)C(=O)N(Cc1cc(OCc3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(OCc3cc(C(C)(C)C)cc(C(C)(C)C)c3)c1)C2=O |
| InChI | InChI=1S/C52H69N3O5/c1-14-15-16-17-20-53-48(58)54-41-18-19-44-45(29-41)47(57)55(46(44)56)31-34-25-42(59-32-35-21-37(49(2,3)4)27-38(22-35)50(5,6)7)30-43(26-34)60-33-36-23-39(51(8,9)10)28-40(24-36)52(11,12)13/h18-19,21-30H,14-17,20,31-33H2,1-13H3,(H2,53,54,58) |
| InChIKey | GIPLUZIYPNDSJC-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.14 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|