C19H28O2Si — CID 101083178
tert-butyl-[[(2S,3R)-3-ethenyl-2-phenyl-2,6-dihydropyran-3-yl]oxy]-dimethylsilane (PubChem CID 101083178) has the molecular formula C19H28O2Si and a molecular weight of 316.52 g/mol. Its IUPAC name is tert-butyl-[[(2S,3R)-3-ethenyl-2-phenyl-2,6-dihydropyran-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,3R)-3-ethenyl-2-phenyl-2,6-dihydropyran-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101083178 |
| Molecular Formula | C19H28O2Si |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl-[[(2S,3R)-3-ethenyl-2-phenyl-2,6-dihydropyran-3-yl]oxy]-dimethylsilane |
| SMILES | C=C[C@@]1(O[Si](C)(C)C(C)(C)C)C=CCO[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H28O2Si/c1-7-19(21-22(5,6)18(2,3)4)14-11-15-20-17(19)16-12-9-8-10-13-16/h7-14,17H,1,15H2,2-6H3/t17-,19+/m0/s1 |
| InChIKey | GGIRXEKDTMIHGP-PKOBYXMFSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|