C20H24NO2 — CID 101083628
CID 101083628 (PubChem CID 101083628) has the molecular formula C20H24NO2 and a molecular weight of 310.42 g/mol.
| Compound Name | CID 101083628 |
|---|---|
| PubChem CID | 101083628 |
| Molecular Formula | C20H24NO2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC(C)(c2ccccc2OCc2ccccc2)N1[O] |
| InChI | InChI=1S/C20H24NO2/c1-19(2)13-14-20(3,21(19)22)17-11-7-8-12-18(17)23-15-16-9-5-4-6-10-16/h4-12H,13-15H2,1-3H3 |
| InChIKey | AXBUQRSDCBREBA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |