C20H20FNO5S — CID 101084075
(4aS,6S,7R,8S,8aR)-6-fluoro-8-methyl-8-nitro-2-phenyl-7-phenylsulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine (PubChem CID 101084075) has the molecular formula C20H20FNO5S and a molecular weight of 405.45 g/mol. Its IUPAC name is (4aS,6S,7R,8S,8aR)-6-fluoro-8-methyl-8-nitro-2-phenyl-7-phenylsulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aS,6S,7R,8S,8aR)-6-fluoro-8-methyl-8-nitro-2-phenyl-7-phenylsulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 101084075 |
| Molecular Formula | C20H20FNO5S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (4aS,6S,7R,8S,8aR)-6-fluoro-8-methyl-8-nitro-2-phenyl-7-phenylsulfanyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine |
| SMILES | C[C@]1([N+](=O)[O-])[C@H]2OC(c3ccccc3)OC[C@@H]2O[C@@H](F)[C@@H]1Sc1ccccc1 |
| InChI | InChI=1S/C20H20FNO5S/c1-20(22(23)24)16-15(12-25-19(27-16)13-8-4-2-5-9-13)26-18(21)17(20)28-14-10-6-3-7-11-14/h2-11,15-19H,12H2,1H3/t15-,16-,17-,18+,19?,20-/m0/s1 |
| InChIKey | DAEKYIQDTYEOLV-IDKZPZPASA-N |
| XLogP | 3.99 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|