C20H21NO6S — CID 134878654
(2S,4aR,6R,7S,8S,8aR)-8-methyl-8-nitro-2-phenyl-6-phenylsulfanyl-2,3,4a,6,7,8a-hexahydropyrano[2,3-b][1,4]dioxin-7-ol (PubChem CID 134878654) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is (2S,4aR,6R,7S,8S,8aR)-8-methyl-8-nitro-2-phenyl-6-phenylsulfanyl-2,3,4a,6,7,8a-hexahydropyrano[2,3-b][1,4]dioxin-7-ol.
| Compound Name | (2S,4aR,6R,7S,8S,8aR)-8-methyl-8-nitro-2-phenyl-6-phenylsulfanyl-2,3,4a,6,7,8a-hexahydropyrano[2,3-b][1,4]dioxin-7-ol |
|---|---|
| PubChem CID | 134878654 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (2S,4aR,6R,7S,8S,8aR)-8-methyl-8-nitro-2-phenyl-6-phenylsulfanyl-2,3,4a,6,7,8a-hexahydropyrano[2,3-b][1,4]dioxin-7-ol |
| SMILES | C[C@]1([N+](=O)[O-])[C@H](O)[C@@H](Sc2ccccc2)O[C@H]2OC[C@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C20H21NO6S/c1-20(21(23)24)16(22)19(28-14-10-6-3-7-11-14)27-18-17(20)26-15(12-25-18)13-8-4-2-5-9-13/h2-11,15-19,22H,12H2,1H3/t15-,16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | MVNZVXLLCPSNIB-FFDFYAMSSA-N |
| XLogP | 3.01 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|