C19H32O2 — CID 10108409
2,4,6-tritert-butyl-4-methoxycyclohexa-2,5-dien-1-one (PubChem CID 10108409) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-4-methoxycyclohexa-2,5-dien-1-one.
| Compound Name | 2,4,6-tritert-butyl-4-methoxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10108409 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 2,4,6-tritert-butyl-4-methoxycyclohexa-2,5-dien-1-one |
| SMILES | COC1(C(C)(C)C)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C19H32O2/c1-16(2,3)13-11-19(21-10,18(7,8)9)12-14(15(13)20)17(4,5)6/h11-12H,1-10H3 |
| InChIKey | NNMLIGNGJQXYKN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |