C11H16O2 — CID 101084232
(2S,3aS,7aS)-2-ethenyl-3a-ethyl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran (PubChem CID 101084232) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2S,3aS,7aS)-2-ethenyl-3a-ethyl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran.
| Compound Name | (2S,3aS,7aS)-2-ethenyl-3a-ethyl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran |
|---|---|
| PubChem CID | 101084232 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2S,3aS,7aS)-2-ethenyl-3a-ethyl-2,3,5,7a-tetrahydrofuro[3,2-b]pyran |
| SMILES | C=C[C@@H]1C[C@]2(CC)OCC=C[C@@H]2O1 |
| InChI | InChI=1S/C11H16O2/c1-3-9-8-11(4-2)10(13-9)6-5-7-12-11/h3,5-6,9-10H,1,4,7-8H2,2H3/t9-,10+,11+/m1/s1 |
| InChIKey | BYZBEJOYHPJTKQ-VWYCJHECSA-N |
| XLogP | 2.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|