C12H22O3 — CID 162417336
(2R,3S,6R)-6-butyl-3-methoxy-2-(methoxymethyl)-3,6-dihydro-2H-pyran (PubChem CID 162417336) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (2R,3S,6R)-6-butyl-3-methoxy-2-(methoxymethyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2R,3S,6R)-6-butyl-3-methoxy-2-(methoxymethyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 162417336 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (2R,3S,6R)-6-butyl-3-methoxy-2-(methoxymethyl)-3,6-dihydro-2H-pyran |
| SMILES | CCCC[C@@H]1C=C[C@H](OC)[C@@H](COC)O1 |
| InChI | InChI=1S/C12H22O3/c1-4-5-6-10-7-8-11(14-3)12(15-10)9-13-2/h7-8,10-12H,4-6,9H2,1-3H3/t10-,11+,12-/m1/s1 |
| InChIKey | YSCWASNMHHEJRD-GRYCIOLGSA-N |
| XLogP | 2.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|