C10H18O2 — CID 13244917
3,6-Diethoxycyclohexene (PubChem CID 13244917) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 3,6-diethoxycyclohexene.
| Compound Name | 3,6-Diethoxycyclohexene |
|---|---|
| PubChem CID | 13244917 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 3,6-diethoxycyclohexene |
| SMILES | CCOC1CCC(C=C1)OCC |
| InChI | InChI=1S/C10H18O2/c1-3-11-9-5-7-10(8-6-9)12-4-2/h5,7,9-10H,3-4,6,8H2,1-2H3 |
| InChIKey | WEBGHMJGXDZMHT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | 127 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|