C13H24O2 — CID 24744770
(3R,4S)-3-propoxy-4-(2-propoxyethyl)cyclopentene (PubChem CID 24744770) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (3R,4S)-3-propoxy-4-(2-propoxyethyl)cyclopentene.
| Compound Name | (3R,4S)-3-propoxy-4-(2-propoxyethyl)cyclopentene |
|---|---|
| PubChem CID | 24744770 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (3R,4S)-3-propoxy-4-(2-propoxyethyl)cyclopentene |
| SMILES | CCCOCC[C@@H]1CC=C[C@@H]1OCCC |
| InChI | InChI=1S/C13H24O2/c1-3-9-14-11-8-12-6-5-7-13(12)15-10-4-2/h5,7,12-13H,3-4,6,8-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | UUOBBYAFNLUVOP-STQMWFEESA-N |
| XLogP | 3.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|