C21H40O2 — CID 24744921
(3R,4S)-4-[2-(3-methylbutoxy)ethyl]-3-nonoxycyclopentene (PubChem CID 24744921) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is (3R,4S)-4-[2-(3-methylbutoxy)ethyl]-3-nonoxycyclopentene.
| Compound Name | (3R,4S)-4-[2-(3-methylbutoxy)ethyl]-3-nonoxycyclopentene |
|---|---|
| PubChem CID | 24744921 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | (3R,4S)-4-[2-(3-methylbutoxy)ethyl]-3-nonoxycyclopentene |
| SMILES | CCCCCCCCCO[C@H]1C=CC[C@H]1CCOCCC(C)C |
| InChI | InChI=1S/C21H40O2/c1-4-5-6-7-8-9-10-16-23-21-13-11-12-20(21)15-18-22-17-14-19(2)3/h11,13,19-21H,4-10,12,14-18H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | RARONMVSEDXYIY-SFTDATJTSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|