C11H20O2 — CID 24744920
2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethanol (PubChem CID 24744920) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethanol.
| Compound Name | 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethanol |
|---|---|
| PubChem CID | 24744920 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-[(1S,2R)-2-butoxycyclopent-3-en-1-yl]ethanol |
| SMILES | CCCCO[C@H]1C=CC[C@H]1CCO |
| InChI | InChI=1S/C11H20O2/c1-2-3-9-13-11-6-4-5-10(11)7-8-12/h4,6,10-12H,2-3,5,7-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | XKHZPVFBXIOQBS-QWRGUYRKSA-N |
| XLogP | 2.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|