C33H30N2O7S — CID 101084897
2-[[4-[2-(1-benzofuran-2-carbonylamino)ethoxy]phenyl]sulfonyl-benzylamino]-4,6-dimethylbenzoic acid (PubChem CID 101084897) has the molecular formula C33H30N2O7S and a molecular weight of 598.68 g/mol. Its IUPAC name is 2-[[4-[2-(1-benzofuran-2-carbonylamino)ethoxy]phenyl]sulfonyl-benzylamino]-4,6-dimethylbenzoic acid.
| Compound Name | 2-[[4-[2-(1-benzofuran-2-carbonylamino)ethoxy]phenyl]sulfonyl-benzylamino]-4,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 101084897 |
| Molecular Formula | C33H30N2O7S |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | 2-[[4-[2-(1-benzofuran-2-carbonylamino)ethoxy]phenyl]sulfonyl-benzylamino]-4,6-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(C(=O)O)c(N(Cc2ccccc2)S(=O)(=O)c2ccc(OCCNC(=O)c3cc4ccccc4o3)cc2)c1 |
| InChI | InChI=1S/C33H30N2O7S/c1-22-18-23(2)31(33(37)38)28(19-22)35(21-24-8-4-3-5-9-24)43(39,40)27-14-12-26(13-15-27)41-17-16-34-32(36)30-20-25-10-6-7-11-29(25)42-30/h3-15,18-20H,16-17,21H2,1-2H3,(H,34,36)(H,37,38) |
| InChIKey | HAQAFCZPYGOJFF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|