C33H31N3O7S — CID 101084898
N-[2-[4-[benzyl-[2-(hydroxycarbamoyl)-3,5-dimethylphenyl]sulfamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide (PubChem CID 101084898) has the molecular formula C33H31N3O7S and a molecular weight of 613.69 g/mol. Its IUPAC name is N-[2-[4-[benzyl-[2-(hydroxycarbamoyl)-3,5-dimethylphenyl]sulfamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-[4-[benzyl-[2-(hydroxycarbamoyl)-3,5-dimethylphenyl]sulfamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 101084898 |
| Molecular Formula | C33H31N3O7S |
| Molecular Weight | 613.69 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | N-[2-[4-[benzyl-[2-(hydroxycarbamoyl)-3,5-dimethylphenyl]sulfamoyl]phenoxy]ethyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(C)c(C(=O)NO)c(N(Cc2ccccc2)S(=O)(=O)c2ccc(OCCNC(=O)c3cc4ccccc4o3)cc2)c1 |
| InChI | InChI=1S/C33H31N3O7S/c1-22-18-23(2)31(33(38)35-39)28(19-22)36(21-24-8-4-3-5-9-24)44(40,41)27-14-12-26(13-15-27)42-17-16-34-32(37)30-20-25-10-6-7-11-29(25)43-30/h3-15,18-20,39H,16-17,21H2,1-2H3,(H,34,37)(H,35,38) |
| InChIKey | AXRKPGAWIDVSAZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.69 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|