C16H20O4S — CID 101085186
2-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]oxane (PubChem CID 101085186) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]oxane.
| Compound Name | 2-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]oxane |
|---|---|
| PubChem CID | 101085186 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[4-(4-methylphenyl)sulfonyl-2,3-dihydrofuran-5-yl]oxane |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(C3CCCCO3)OCC2)cc1 |
| InChI | InChI=1S/C16H20O4S/c1-12-5-7-13(8-6-12)21(17,18)15-9-11-20-16(15)14-4-2-3-10-19-14/h5-8,14H,2-4,9-11H2,1H3 |
| InChIKey | YZTPIELBNCUGSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |