C11H14O3 — CID 101088614
(5S)-4-hydroxy-3,5-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]furan-2-one (PubChem CID 101088614) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (5S)-4-hydroxy-3,5-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]furan-2-one.
| Compound Name | (5S)-4-hydroxy-3,5-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]furan-2-one |
|---|---|
| PubChem CID | 101088614 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (5S)-4-hydroxy-3,5-dimethyl-5-[(1E)-2-methylbuta-1,3-dienyl]furan-2-one |
| SMILES | C=C/C(C)=C/[C@]1(C)OC(=O)C(C)=C1O |
| InChI | InChI=1S/C11H14O3/c1-5-7(2)6-11(4)9(12)8(3)10(13)14-11/h5-6,12H,1H2,2-4H3/b7-6+/t11-/m0/s1 |
| InChIKey | PIIAVOFMPZPOPY-MLRMMBSGSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|