C8H13IO — CID 101089137
trans-(2R,3R)-2-iodo-3-methylcycloheptan-1-one (PubChem CID 101089137) has the molecular formula C8H13IO and a molecular weight of 252.09 g/mol. Its IUPAC name is trans-(2R,3R)-2-iodo-3-methylcycloheptan-1-one.
| Compound Name | trans-(2R,3R)-2-iodo-3-methylcycloheptan-1-one |
|---|---|
| PubChem CID | 101089137 |
| Molecular Formula | C8H13IO |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | trans-(2R,3R)-2-iodo-3-methylcycloheptan-1-one |
| SMILES | C[C@@H]1CCCCC(=O)[C@@H]1I |
| InChI | InChI=1S/C8H13IO/c1-6-4-2-3-5-7(10)8(6)9/h6,8H,2-5H2,1H3/t6-,8-/m1/s1 |
| InChIKey | QPFDRASJYMEBNP-HTRCEHHLSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|