C30H23BrN2O4 — CID 101090026
3-bromo-2,9-bis(2,6-dimethoxyphenyl)-8-ethynyl-1,10-phenanthroline (PubChem CID 101090026) has the molecular formula C30H23BrN2O4 and a molecular weight of 555.43 g/mol. Its IUPAC name is 3-bromo-2,9-bis(2,6-dimethoxyphenyl)-8-ethynyl-1,10-phenanthroline.
| Compound Name | 3-bromo-2,9-bis(2,6-dimethoxyphenyl)-8-ethynyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 101090026 |
| Molecular Formula | C30H23BrN2O4 |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 3-bromo-2,9-bis(2,6-dimethoxyphenyl)-8-ethynyl-1,10-phenanthroline |
| SMILES | C#Cc1cc2ccc3cc(Br)c(-c4c(OC)cccc4OC)nc3c2nc1-c1c(OC)cccc1OC |
| InChI | InChI=1S/C30H23BrN2O4/c1-6-17-15-18-13-14-19-16-20(31)30(26-23(36-4)11-8-12-24(26)37-5)33-29(19)28(18)32-27(17)25-21(34-2)9-7-10-22(25)35-3/h1,7-16H,2-5H3 |
| InChIKey | YCUARCOFLNGQIV-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|