C29H25ClN2O4 — CID 11813089
2-[4-(chloromethyl)-2,6-dimethoxyphenyl]-9-(2,6-dimethoxyphenyl)-1,10-phenanthroline (PubChem CID 11813089) has the molecular formula C29H25ClN2O4 and a molecular weight of 500.98 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2,6-dimethoxyphenyl]-9-(2,6-dimethoxyphenyl)-1,10-phenanthroline.
| Compound Name | 2-[4-(chloromethyl)-2,6-dimethoxyphenyl]-9-(2,6-dimethoxyphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 11813089 |
| Molecular Formula | C29H25ClN2O4 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-[4-(chloromethyl)-2,6-dimethoxyphenyl]-9-(2,6-dimethoxyphenyl)-1,10-phenanthroline |
| SMILES | COc1cccc(OC)c1-c1ccc2ccc3ccc(-c4c(OC)cc(CCl)cc4OC)nc3c2n1 |
| InChI | InChI=1S/C29H25ClN2O4/c1-33-22-6-5-7-23(34-2)26(22)20-12-10-18-8-9-19-11-13-21(32-29(19)28(18)31-20)27-24(35-3)14-17(16-30)15-25(27)36-4/h5-15H,16H2,1-4H3 |
| InChIKey | GHGYRSDIQGSJNR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|