C36H36N2O8 — CID 11006673
diethyl 2-[[4-[9-(2,6-dimethoxyphenyl)-1,10-phenanthrolin-2-yl]-3,5-dimethoxyphenyl]methyl]propanedioate (PubChem CID 11006673) has the molecular formula C36H36N2O8 and a molecular weight of 624.69 g/mol. Its IUPAC name is diethyl 2-[[4-[9-(2,6-dimethoxyphenyl)-1,10-phenanthrolin-2-yl]-3,5-dimethoxyphenyl]methyl]propanedioate.
| Compound Name | diethyl 2-[[4-[9-(2,6-dimethoxyphenyl)-1,10-phenanthrolin-2-yl]-3,5-dimethoxyphenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 11006673 |
| Molecular Formula | C36H36N2O8 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | diethyl 2-[[4-[9-(2,6-dimethoxyphenyl)-1,10-phenanthrolin-2-yl]-3,5-dimethoxyphenyl]methyl]propanedioate |
| SMILES | CCOC(=O)C(Cc1cc(OC)c(-c2ccc3ccc4ccc(-c5c(OC)cccc5OC)nc4c3n2)c(OC)c1)C(=O)OCC |
| InChI | InChI=1S/C36H36N2O8/c1-7-45-35(39)24(36(40)46-8-2)18-21-19-29(43-5)32(30(20-21)44-6)26-17-15-23-13-12-22-14-16-25(37-33(22)34(23)38-26)31-27(41-3)10-9-11-28(31)42-4/h9-17,19-20,24H,7-8,18H2,1-6H3 |
| InChIKey | OSXDAXODLXIVPE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|