C18H12F2O4S — CID 10109260
4-(3,4-difluorophenyl)-3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-2H-furan-5-one (PubChem CID 10109260) has the molecular formula C18H12F2O4S and a molecular weight of 362.35 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-2H-furan-5-one.
| Compound Name | 4-(3,4-difluorophenyl)-3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-2H-furan-5-one |
|---|---|
| PubChem CID | 10109260 |
| Molecular Formula | C18H12F2O4S |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 4-(3,4-difluorophenyl)-3-(1,1-dioxo-2,3-dihydro-1-benzothiophen-6-yl)-2H-furan-5-one |
| SMILES | O=C1OCC(c2ccc3c(c2)S(=O)(=O)CC3)=C1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H12F2O4S/c19-14-4-3-12(7-15(14)20)17-13(9-24-18(17)21)11-2-1-10-5-6-25(22,23)16(10)8-11/h1-4,7-8H,5-6,9H2 |
| InChIKey | JQYGYSLRVGKOPW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|