C12H12O4S — CID 154573795
prop-2-enyl (3R)-1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylate (PubChem CID 154573795) has the molecular formula C12H12O4S and a molecular weight of 252.29 g/mol. Its IUPAC name is prop-2-enyl (3R)-1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylate.
| Compound Name | prop-2-enyl (3R)-1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 154573795 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | prop-2-enyl (3R)-1,1-dioxo-2,3-dihydro-1-benzothiophene-3-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C12H12O4S/c1-2-7-16-12(13)10-8-17(14,15)11-6-4-3-5-9(10)11/h2-6,10H,1,7-8H2/t10-/m1/s1 |
| InChIKey | FZYNHWOAZRRURO-SNVBAGLBSA-N |
| XLogP | 1.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|