About (E)-2-methyltridec-2-en-4,6-diynoic acid
(E)-2-methyltridec-2-en-4,6-diynoic acid (PubChem CID 101092837) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is (E)-2-methyltridec-2-en-4,6-diynoic acid.
Molecular Properties
| Compound Name | (E)-2-methyltridec-2-en-4,6-diynoic acid |
| PubChem CID | 101092837 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (E)-2-methyltridec-2-en-4,6-diynoic acid |
| SMILES | CCCCCCC#CC#C/C=C(\C)C(=O)O |
| InChI | InChI=1S/C14H18O2/c1-3-4-5-6-7-8-9-10-11-12-13(2)14(15)16/h12H,3-7H2,1-2H3,(H,15,16)/b13-12+ |
| InChIKey | IYRHQPXWQRCPRN-OUKQBFOZSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methyltridec-2-en-4,6-diynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methyltridec-2-en-4,6-diynoic acid?
The IUPAC name of (E)-2-methyltridec-2-en-4,6-diynoic acid (CID 101092837) is (E)-2-methyltridec-2-en-4,6-diynoic acid.
What is the SMILES notation for (E)-2-methyltridec-2-en-4,6-diynoic acid?
The canonical SMILES for (E)-2-methyltridec-2-en-4,6-diynoic acid is CCCCCCC#CC#C/C=C(\C)C(=O)O.
What is the InChIKey of (E)-2-methyltridec-2-en-4,6-diynoic acid?
The InChIKey is IYRHQPXWQRCPRN-OUKQBFOZSA-N. The full InChI is InChI=1S/C14H18O2/c1-3-4-5-6-7-8-9-10-11-12-13(2)14(15)16/h12H,3-7H2,1-2H3,(H,15,16)/b13-12+.
What are the key properties of (E)-2-methyltridec-2-en-4,6-diynoic acid?
(E)-2-methyltridec-2-en-4,6-diynoic acid has a molecular weight of 218.30 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methyltridec-2-en-4,6-diynoic acid is sourced from PubChem (CID 101092837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).