C16H20F3NO3S — CID 10109311
propan-2-yl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate (PubChem CID 10109311) has the molecular formula C16H20F3NO3S and a molecular weight of 363.40 g/mol. Its IUPAC name is propan-2-yl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | propan-2-yl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10109311 |
| Molecular Formula | C16H20F3NO3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | propan-2-yl (2S,4R)-4-sulfanyl-2-[(2,4,5-trifluorophenyl)methoxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1C[C@H](S)C[C@H]1COCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H20F3NO3S/c1-9(2)23-16(21)20-6-12(24)4-11(20)8-22-7-10-3-14(18)15(19)5-13(10)17/h3,5,9,11-12,24H,4,6-8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | FLIJVQXHLWMTDC-NWDGAFQWSA-N |
| XLogP | 3.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|