C9H12F3NO5 — CID 101093757
5-[formyl(2,2,2-trifluoroethoxycarbonyl)amino]pentanoic acid (PubChem CID 101093757) has the molecular formula C9H12F3NO5 and a molecular weight of 271.19 g/mol. Its IUPAC name is 5-[formyl(2,2,2-trifluoroethoxycarbonyl)amino]pentanoic acid.
| Compound Name | 5-[formyl(2,2,2-trifluoroethoxycarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 101093757 |
| Molecular Formula | C9H12F3NO5 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 5-[formyl(2,2,2-trifluoroethoxycarbonyl)amino]pentanoic acid |
| SMILES | O=CN(CCCCC(=O)O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H12F3NO5/c10-9(11,12)5-18-8(17)13(6-14)4-2-1-3-7(15)16/h6H,1-5H2,(H,15,16) |
| InChIKey | DNMHMSXRCCZYBX-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|