C21H29NO2Se — CID 101096407
(1R)-1-[2-[(1S,2R)-2-ethoxy-2-methoxy-1-phenylethyl]selanylphenyl]-N,N-dimethylethanamine (PubChem CID 101096407) has the molecular formula C21H29NO2Se and a molecular weight of 406.43 g/mol. Its IUPAC name is (1R)-1-[2-[(1S,2R)-2-ethoxy-2-methoxy-1-phenylethyl]selanylphenyl]-N,N-dimethylethanamine.
| Compound Name | (1R)-1-[2-[(1S,2R)-2-ethoxy-2-methoxy-1-phenylethyl]selanylphenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 101096407 |
| Molecular Formula | C21H29NO2Se |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (1R)-1-[2-[(1S,2R)-2-ethoxy-2-methoxy-1-phenylethyl]selanylphenyl]-N,N-dimethylethanamine |
| SMILES | CCO[C@@H](OC)[C@@H]([Se]c1ccccc1[C@@H](C)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H29NO2Se/c1-6-24-21(23-5)20(17-12-8-7-9-13-17)25-19-15-11-10-14-18(19)16(2)22(3)4/h7-16,20-21H,6H2,1-5H3/t16-,20+,21-/m1/s1 |
| InChIKey | JGFITEBBLVTOTD-TYCQWZJGSA-N |
| XLogP | 3.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|