C36H42O10 — CID 101096703
(9R,10R)-5-methoxy-4,8,8-trimethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-h]chromen-2-one (PubChem CID 101096703) has the molecular formula C36H42O10 and a molecular weight of 634.72 g/mol. Its IUPAC name is (9R,10R)-5-methoxy-4,8,8-trimethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-h]chromen-2-one.
| Compound Name | (9R,10R)-5-methoxy-4,8,8-trimethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-h]chromen-2-one |
|---|---|
| PubChem CID | 101096703 |
| Molecular Formula | C36H42O10 |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.28 |
| IUPAC Name | (9R,10R)-5-methoxy-4,8,8-trimethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-h]chromen-2-one |
| SMILES | COc1cc2c(c3oc(=O)cc(C)c13)[C@H](C(=O)[C@@]13CC[C@@](C)(C(=O)O1)C3(C)C)[C@@H](C(=O)[C@@]13CC[C@@](C)(C(=O)O1)C3(C)C)C(C)(C)O2 |
| InChI | InChI=1S/C36H42O10/c1-17-15-20(37)43-25-21(17)18(42-10)16-19-22(25)23(26(38)35-13-11-33(8,28(40)45-35)31(35,4)5)24(30(2,3)44-19)27(39)36-14-12-34(9,29(41)46-36)32(36,6)7/h15-16,23-24H,11-14H2,1-10H3/t23-,24-,33-,34-,35+,36+/m0/s1 |
| InChIKey | KZAWQIXVMASRTG-CYGVDLAMSA-N |
| XLogP | 5.36 |
| TPSA | 135.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|