C36H42O9 — CID 101096697
(9R,10R)-4,6,8,8-tetramethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-f]chromen-2-one (PubChem CID 101096697) has the molecular formula C36H42O9 and a molecular weight of 618.72 g/mol. Its IUPAC name is (9R,10R)-4,6,8,8-tetramethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-f]chromen-2-one.
| Compound Name | (9R,10R)-4,6,8,8-tetramethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-f]chromen-2-one |
|---|---|
| PubChem CID | 101096697 |
| Molecular Formula | C36H42O9 |
| Molecular Weight | 618.72 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | (9R,10R)-4,6,8,8-tetramethyl-9,10-bis[(1S,4R)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carbonyl]-9,10-dihydropyrano[2,3-f]chromen-2-one |
| SMILES | Cc1cc2c(C)cc(=O)oc2c2c1OC(C)(C)[C@H](C(=O)[C@@]13CC[C@@](C)(C(=O)O1)C3(C)C)[C@H]2C(=O)[C@@]12CC[C@@](C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C36H42O9/c1-17-16-20(37)42-25-19(17)15-18(2)24-22(25)21(26(38)35-13-11-33(9,28(40)44-35)31(35,5)6)23(30(3,4)43-24)27(39)36-14-12-34(10,29(41)45-36)32(36,7)8/h15-16,21,23H,11-14H2,1-10H3/t21-,23-,33-,34-,35+,36+/m0/s1 |
| InChIKey | VBRIGOSEAULXNT-SQLQZXDXSA-N |
| XLogP | 5.66 |
| TPSA | 126.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|