C18H33NO6 — CID 101096882
(10R)-10-[(3S,5R,6R,7R)-6,7-dihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]-1,10-dihydroxydecan-5-one (PubChem CID 101096882) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is (10R)-10-[(3S,5R,6R,7R)-6,7-dihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]-1,10-dihydroxydecan-5-one.
| Compound Name | (10R)-10-[(3S,5R,6R,7R)-6,7-dihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]-1,10-dihydroxydecan-5-one |
|---|---|
| PubChem CID | 101096882 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (10R)-10-[(3S,5R,6R,7R)-6,7-dihydroxy-5-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-3-yl]-1,10-dihydroxydecan-5-one |
| SMILES | O=C(CCCCO)CCCC[C@@H](O)[C@@H]1CCC2[C@@H](O)[C@H](O)[C@@H](CO)N21 |
| InChI | InChI=1S/C18H33NO6/c20-10-4-3-6-12(22)5-1-2-7-16(23)13-8-9-14-17(24)18(25)15(11-21)19(13)14/h13-18,20-21,23-25H,1-11H2/t13-,14?,15+,16+,17+,18+/m0/s1 |
| InChIKey | WGEIJHUJKRVXNI-YQVSHGKTSA-N |
| XLogP | -0.43 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|