C8H13NO5 — CID 134945357
(1S,5R,6R,7R,8R)-1,6,7-trihydroxy-5-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 134945357) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is (1S,5R,6R,7R,8R)-1,6,7-trihydroxy-5-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,5R,6R,7R,8R)-1,6,7-trihydroxy-5-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 134945357 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (1S,5R,6R,7R,8R)-1,6,7-trihydroxy-5-(hydroxymethyl)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1C[C@H](O)[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)N12 |
| InChI | InChI=1S/C8H13NO5/c10-2-3-7(13)8(14)6-4(11)1-5(12)9(3)6/h3-4,6-8,10-11,13-14H,1-2H2/t3-,4+,6-,7-,8-/m1/s1 |
| InChIKey | VSGPCFFJCYTHCY-YUEVFOICSA-N |
| XLogP | -2.96 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |