C20H28F3NO2 — CID 101097924
N-[(1S,2S)-1-[(3S,4R)-4-ethyl-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 101097924) has the molecular formula C20H28F3NO2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(1S,2S)-1-[(3S,4R)-4-ethyl-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,2S)-1-[(3S,4R)-4-ethyl-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101097924 |
| Molecular Formula | C20H28F3NO2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | N-[(1S,2S)-1-[(3S,4R)-4-ethyl-3-methylhex-5-en-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C=C[C@@H](CC)[C@](C)(CC)O[C@@H](c1ccccc1)[C@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H28F3NO2/c1-6-16(7-2)19(5,8-3)26-17(15-12-10-9-11-13-15)14(4)24-18(25)20(21,22)23/h6,9-14,16-17H,1,7-8H2,2-5H3,(H,24,25)/t14-,16-,17+,19-/m0/s1 |
| InChIKey | SDSCXYDIEZXXQF-RMRDIRSESA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|