C16H20O4 — CID 101098543
methyl (E)-3-[3-[3-(3-methoxyphenyl)propyl]oxiran-2-yl]prop-2-enoate (PubChem CID 101098543) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl (E)-3-[3-[3-(3-methoxyphenyl)propyl]oxiran-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[3-(3-methoxyphenyl)propyl]oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101098543 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl (E)-3-[3-[3-(3-methoxyphenyl)propyl]oxiran-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1OC1CCCc1cccc(OC)c1 |
| InChI | InChI=1S/C16H20O4/c1-18-13-7-3-5-12(11-13)6-4-8-14-15(20-14)9-10-16(17)19-2/h3,5,7,9-11,14-15H,4,6,8H2,1-2H3/b10-9+ |
| InChIKey | BXFDZJBOXZVQPU-MDZDMXLPSA-N |
| XLogP | 2.51 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|