C21H24O5 — CID 173413536
methyl 13-(3-methoxyphenyl)-4,11-dioxotrideca-5,7,9-trienoate (PubChem CID 173413536) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is methyl 13-(3-methoxyphenyl)-4,11-dioxotrideca-5,7,9-trienoate.
| Compound Name | methyl 13-(3-methoxyphenyl)-4,11-dioxotrideca-5,7,9-trienoate |
|---|---|
| PubChem CID | 173413536 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | methyl 13-(3-methoxyphenyl)-4,11-dioxotrideca-5,7,9-trienoate |
| SMILES | COC(=O)CCC(=O)C=CC=CC=CC(=O)CCc1cccc(OC)c1 |
| InChI | InChI=1S/C21H24O5/c1-25-20-11-7-8-17(16-20)12-13-18(22)9-5-3-4-6-10-19(23)14-15-21(24)26-2/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | VJAWYABINLMGSU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|